C20H18Cl2O4 — CID 102045286
[2-(acetyloxymethyl)-3,3-bis(4-chlorophenyl)prop-2-enyl] acetate (PubChem CID 102045286) has the molecular formula C20H18Cl2O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-3,3-bis(4-chlorophenyl)prop-2-enyl] acetate.
| Compound Name | [2-(acetyloxymethyl)-3,3-bis(4-chlorophenyl)prop-2-enyl] acetate |
|---|---|
| PubChem CID | 102045286 |
| Molecular Formula | C20H18Cl2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [2-(acetyloxymethyl)-3,3-bis(4-chlorophenyl)prop-2-enyl] acetate |
| SMILES | CC(=O)OCC(COC(C)=O)=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2O4/c1-13(23)25-11-17(12-26-14(2)24)20(15-3-7-18(21)8-4-15)16-5-9-19(22)10-6-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | ZVTDRBBRIIMSHJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |