C12H14ClNO4 — CID 139815315
(3-acetamido-2-hydroxypropyl) 4-chlorobenzoate (PubChem CID 139815315) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is (3-acetamido-2-hydroxypropyl) 4-chlorobenzoate.
| Compound Name | (3-acetamido-2-hydroxypropyl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 139815315 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (3-acetamido-2-hydroxypropyl) 4-chlorobenzoate |
| SMILES | CC(=O)NCC(O)COC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO4/c1-8(15)14-6-11(16)7-18-12(17)9-2-4-10(13)5-3-9/h2-5,11,16H,6-7H2,1H3,(H,14,15) |
| InChIKey | KFONZLVBSUWKEO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |