C11H11BrCl2O — CID 62395360
2-bromo-1-(3,5-dichlorophenyl)pentan-3-one (PubChem CID 62395360) has the molecular formula C11H11BrCl2O and a molecular weight of 310.02 g/mol. Its IUPAC name is 2-bromo-1-(3,5-dichlorophenyl)pentan-3-one.
| Compound Name | 2-bromo-1-(3,5-dichlorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 62395360 |
| Molecular Formula | C11H11BrCl2O |
| Molecular Weight | 310.02 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | 2-bromo-1-(3,5-dichlorophenyl)pentan-3-one |
| SMILES | CCC(=O)C(Br)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H11BrCl2O/c1-2-11(15)10(12)5-7-3-8(13)6-9(14)4-7/h3-4,6,10H,2,5H2,1H3 |
| InChIKey | SOZDCCVPJPKKCP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.02 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|