C10H12Cl2O — CID 71163653
1-(3,5-dichlorophenyl)butan-2-ol (PubChem CID 71163653) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)butan-2-ol.
| Compound Name | 1-(3,5-dichlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 71163653 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)butan-2-ol |
| SMILES | CCC(O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O/c1-2-10(13)5-7-3-8(11)6-9(12)4-7/h3-4,6,10,13H,2,5H2,1H3 |
| InChIKey | NNFBQCOZSOIIJX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |