C12H16Cl2O — CID 78018332
2-[(3,5-dichlorophenyl)methyl]pentan-1-ol (PubChem CID 78018332) has the molecular formula C12H16Cl2O and a molecular weight of 247.16 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methyl]pentan-1-ol.
| Compound Name | 2-[(3,5-dichlorophenyl)methyl]pentan-1-ol |
|---|---|
| PubChem CID | 78018332 |
| Molecular Formula | C12H16Cl2O |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methyl]pentan-1-ol |
| SMILES | CCCC(CO)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2O/c1-2-3-9(8-15)4-10-5-11(13)7-12(14)6-10/h5-7,9,15H,2-4,8H2,1H3 |
| InChIKey | NDHKOLSJVGFBDF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |