C8H14Br2O4 — CID 58363735
1,2-dibromo-6-hydroxy-5,5-bis(hydroxymethyl)hexan-3-one (PubChem CID 58363735) has the molecular formula C8H14Br2O4 and a molecular weight of 334.00 g/mol. Its IUPAC name is 1,2-dibromo-6-hydroxy-5,5-bis(hydroxymethyl)hexan-3-one.
| Compound Name | 1,2-dibromo-6-hydroxy-5,5-bis(hydroxymethyl)hexan-3-one |
|---|---|
| PubChem CID | 58363735 |
| Molecular Formula | C8H14Br2O4 |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | 1,2-dibromo-6-hydroxy-5,5-bis(hydroxymethyl)hexan-3-one |
| SMILES | O=C(CC(CO)(CO)CO)C(Br)CBr |
| InChI | InChI=1S/C8H14Br2O4/c9-2-6(10)7(14)1-8(3-11,4-12)5-13/h6,11-13H,1-5H2 |
| InChIKey | PQGFVFMKROAZKN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|