C7H9Br2Cl3O2 — CID 158986270
3,4-dibromobutan-2-one;1,1,1-trichloropropan-2-one (PubChem CID 158986270) has the molecular formula C7H9Br2Cl3O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 3,4-dibromobutan-2-one;1,1,1-trichloropropan-2-one.
| Compound Name | 3,4-dibromobutan-2-one;1,1,1-trichloropropan-2-one |
|---|---|
| PubChem CID | 158986270 |
| Molecular Formula | C7H9Br2Cl3O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 387.80 |
| IUPAC Name | 3,4-dibromobutan-2-one;1,1,1-trichloropropan-2-one |
| SMILES | CC(=O)C(Br)CBr.CC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6Br2O.C3H3Cl3O/c1-3(7)4(6)2-5;1-2(7)3(4,5)6/h4H,2H2,1H3;1H3 |
| InChIKey | JPPLNAVIUYFEMA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|