About (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one
(5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one (PubChem CID 174280527) has the molecular formula C12H23BrO
and a molecular weight of 263.22 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one.
Molecular Properties
| Compound Name | (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one |
| PubChem CID | 174280527 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one |
| SMILES | CCC(=O)C(C)[C@H](CBr)CCC(C)C |
| InChI | InChI=1S/C12H23BrO/c1-5-12(14)10(4)11(8-13)7-6-9(2)3/h9-11H,5-8H2,1-4H3/t10?,11-/m0/s1 |
| InChIKey | CAEBPVDJPFYVFQ-DTIOYNMSSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one?
The IUPAC name of (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one (CID 174280527) is (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one.
What is the SMILES notation for (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one?
The canonical SMILES for (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one is CCC(=O)C(C)[C@H](CBr)CCC(C)C.
What is the InChIKey of (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one?
The InChIKey is CAEBPVDJPFYVFQ-DTIOYNMSSA-N. The full InChI is InChI=1S/C12H23BrO/c1-5-12(14)10(4)11(8-13)7-6-9(2)3/h9-11H,5-8H2,1-4H3/t10?,11-/m0/s1.
What are the key properties of (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one?
(5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one has a molecular weight of 263.22 g/mol, XLogP of 4.05, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(bromomethyl)-4,8-dimethylnonan-3-one is sourced from PubChem (CID 174280527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).