C8H11Cl2NO — CID 13324355
2,2-dichloro-N-propyl-N-prop-2-ynylacetamide (PubChem CID 13324355) has the molecular formula C8H11Cl2NO and a molecular weight of 208.09 g/mol. Its IUPAC name is 2,2-dichloro-N-propyl-N-prop-2-ynylacetamide.
| Compound Name | 2,2-dichloro-N-propyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 13324355 |
| Molecular Formula | C8H11Cl2NO |
| Molecular Weight | 208.09 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2,2-dichloro-N-propyl-N-prop-2-ynylacetamide |
| SMILES | C#CCN(CCC)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h1,7H,4-6H2,2H3 |
| InChIKey | UJWOKYNOGMNYTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|