C10H8F6O4 — CID 150888506
[4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroacetyl)but-1-enyl] 2-methylpropanoate (PubChem CID 150888506) has the molecular formula C10H8F6O4 and a molecular weight of 306.16 g/mol. Its IUPAC name is [4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroacetyl)but-1-enyl] 2-methylpropanoate.
| Compound Name | [4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroacetyl)but-1-enyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 150888506 |
| Molecular Formula | C10H8F6O4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | [4,4,4-trifluoro-3-oxo-2-(2,2,2-trifluoroacetyl)but-1-enyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC=C(C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O4/c1-4(2)8(19)20-3-5(6(17)9(11,12)13)7(18)10(14,15)16/h3-4H,1-2H3 |
| InChIKey | KXNKAMCBIIDMIS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|