About CID 87878530
CID 87878530 (PubChem CID 87878530) has the molecular formula C10H16NaO4
and a molecular weight of 223.22 g/mol.
Molecular Properties
| Compound Name | CID 87878530 |
| PubChem CID | 87878530 |
| Molecular Formula | C10H16NaO4 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | — |
| SMILES | CC(C)C(=O)OC(=O)C(=O)C(C)(C)C.[Na] |
| InChI | InChI=1S/C10H16O4.Na/c1-6(2)8(12)14-9(13)7(11)10(3,4)5;/h6H,1-5H3; |
| InChIKey | SWJNERLXZTXGPJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 87878530 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87878530?
The IUPAC name of CID 87878530 (CID 87878530) is not available.
What is the SMILES notation for CID 87878530?
The canonical SMILES for CID 87878530 is CC(C)C(=O)OC(=O)C(=O)C(C)(C)C.[Na].
What is the InChIKey of CID 87878530?
The InChIKey is SWJNERLXZTXGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4.Na/c1-6(2)8(12)14-9(13)7(11)10(3,4)5;/h6H,1-5H3;.
What are the key properties of CID 87878530?
CID 87878530 has a molecular weight of 223.22 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87878530 is sourced from PubChem (CID 87878530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).