C14H26O5Ti — CID 87613447
2,2-dimethylpropanoyl 3,3-dimethyl-2-oxobutanoate;propan-2-ol;titanium (PubChem CID 87613447) has the molecular formula C14H26O5Ti and a molecular weight of 322.22 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 3,3-dimethyl-2-oxobutanoate;propan-2-ol;titanium.
| Compound Name | 2,2-dimethylpropanoyl 3,3-dimethyl-2-oxobutanoate;propan-2-ol;titanium |
|---|---|
| PubChem CID | 87613447 |
| Molecular Formula | C14H26O5Ti |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2,2-dimethylpropanoyl 3,3-dimethyl-2-oxobutanoate;propan-2-ol;titanium |
| SMILES | CC(C)(C)C(=O)OC(=O)C(=O)C(C)(C)C.CC(C)O.[Ti] |
| InChI | InChI=1S/C11H18O4.C3H8O.Ti/c1-10(2,3)7(12)8(13)15-9(14)11(4,5)6;1-3(2)4;/h1-6H3;3-4H,1-2H3; |
| InChIKey | ABCINIRXBGAZNG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|