About (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one
(4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one (PubChem CID 156683675) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one.
Molecular Properties
| Compound Name | (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one |
| PubChem CID | 156683675 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one |
| SMILES | CO/N=C(/C(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C10H19NO2/c1-7(2)8(11-13-6)9(12)10(3,4)5/h7H,1-6H3/b11-8+ |
| InChIKey | SSKCCDQWEULNLZ-DHZHZOJOSA-N |
| XLogP | 2.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one?
The IUPAC name of (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one (CID 156683675) is (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one.
What is the SMILES notation for (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one?
The canonical SMILES for (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one is CO/N=C(/C(=O)C(C)(C)C)C(C)C.
What is the InChIKey of (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one?
The InChIKey is SSKCCDQWEULNLZ-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H19NO2/c1-7(2)8(11-13-6)9(12)10(3,4)5/h7H,1-6H3/b11-8+.
What are the key properties of (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one?
(4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one has a molecular weight of 185.27 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-methoxyimino-2,2,5-trimethylhexan-3-one is sourced from PubChem (CID 156683675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).