C15H12Cl2FNO4 — CID 54377300
ethyl 2-(2,4-dichloro-3-cyano-5-fluorobenzoyl)-3-ethoxyprop-2-enoate (PubChem CID 54377300) has the molecular formula C15H12Cl2FNO4 and a molecular weight of 360.17 g/mol. Its IUPAC name is ethyl 2-(2,4-dichloro-3-cyano-5-fluorobenzoyl)-3-ethoxyprop-2-enoate.
| Compound Name | ethyl 2-(2,4-dichloro-3-cyano-5-fluorobenzoyl)-3-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 54377300 |
| Molecular Formula | C15H12Cl2FNO4 |
| Molecular Weight | 360.17 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | ethyl 2-(2,4-dichloro-3-cyano-5-fluorobenzoyl)-3-ethoxyprop-2-enoate |
| SMILES | CCOC=C(C(=O)OCC)C(=O)c1cc(F)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C15H12Cl2FNO4/c1-3-22-7-10(15(21)23-4-2)14(20)8-5-11(18)13(17)9(6-19)12(8)16/h5,7H,3-4H2,1-2H3 |
| InChIKey | UXKVLVXYIDXFSF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.17 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|