C12H11ClN2O3 — CID 107140947
2-[3-(5-chloro-2-cyanophenoxy)azetidin-3-yl]acetic acid (PubChem CID 107140947) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 2-[3-(5-chloro-2-cyanophenoxy)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(5-chloro-2-cyanophenoxy)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107140947 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[3-(5-chloro-2-cyanophenoxy)azetidin-3-yl]acetic acid |
| SMILES | N#Cc1ccc(Cl)cc1OC1(CC(=O)O)CNC1 |
| InChI | InChI=1S/C12H11ClN2O3/c13-9-2-1-8(5-14)10(3-9)18-12(4-11(16)17)6-15-7-12/h1-3,15H,4,6-7H2,(H,16,17) |
| InChIKey | QTBOETMREDLZKF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |