C13H14BrCl2NO3 — CID 107499504
1-[[1-(bromomethyl)cyclopentyl]methoxy]-4,5-dichloro-2-nitrobenzene (PubChem CID 107499504) has the molecular formula C13H14BrCl2NO3 and a molecular weight of 383.07 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclopentyl]methoxy]-4,5-dichloro-2-nitrobenzene.
| Compound Name | 1-[[1-(bromomethyl)cyclopentyl]methoxy]-4,5-dichloro-2-nitrobenzene |
|---|---|
| PubChem CID | 107499504 |
| Molecular Formula | C13H14BrCl2NO3 |
| Molecular Weight | 383.07 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclopentyl]methoxy]-4,5-dichloro-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1OCC1(CBr)CCCC1 |
| InChI | InChI=1S/C13H14BrCl2NO3/c14-7-13(3-1-2-4-13)8-20-12-6-10(16)9(15)5-11(12)17(18)19/h5-6H,1-4,7-8H2 |
| InChIKey | UKXGAWNDFKFXHE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.07 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|