C14H16BrCl2NO3 — CID 65002104
2-[[1-(bromomethyl)cyclohexyl]methoxy]-1,3-dichloro-5-nitrobenzene (PubChem CID 65002104) has the molecular formula C14H16BrCl2NO3 and a molecular weight of 397.10 g/mol. Its IUPAC name is 2-[[1-(bromomethyl)cyclohexyl]methoxy]-1,3-dichloro-5-nitrobenzene.
| Compound Name | 2-[[1-(bromomethyl)cyclohexyl]methoxy]-1,3-dichloro-5-nitrobenzene |
|---|---|
| PubChem CID | 65002104 |
| Molecular Formula | C14H16BrCl2NO3 |
| Molecular Weight | 397.10 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 2-[[1-(bromomethyl)cyclohexyl]methoxy]-1,3-dichloro-5-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(OCC2(CBr)CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H16BrCl2NO3/c15-8-14(4-2-1-3-5-14)9-21-13-11(16)6-10(18(19)20)7-12(13)17/h6-7H,1-5,8-9H2 |
| InChIKey | GSTFOUDSYRRMFK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.10 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|