C14H15Cl2N3OS — CID 735079
3,4-dichloro-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 735079) has the molecular formula C14H15Cl2N3OS and a molecular weight of 344.27 g/mol. Its IUPAC name is 3,4-dichloro-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 735079 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3,4-dichloro-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCC(CC)c1nnc(NC(=O)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C14H15Cl2N3OS/c1-3-8(4-2)13-18-19-14(21-13)17-12(20)9-5-6-10(15)11(16)7-9/h5-8H,3-4H2,1-2H3,(H,17,19,20) |
| InChIKey | FLADDWPGWQSMPW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |