C15H16F3N3OS — CID 35865479
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethyl)benzamide (PubChem CID 35865479) has the molecular formula C15H16F3N3OS and a molecular weight of 343.37 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 35865479 |
| Molecular Formula | C15H16F3N3OS |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CCC(CC)c1nnc(NC(=O)c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C15H16F3N3OS/c1-3-9(4-2)13-20-21-14(23-13)19-12(22)10-5-7-11(8-6-10)15(16,17)18/h5-9H,3-4H2,1-2H3,(H,19,21,22) |
| InChIKey | AYJHFRIOXSDOAA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |