C17H22N4O2S — CID 17257379
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(propanoylamino)benzamide (PubChem CID 17257379) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(propanoylamino)benzamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 17257379 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-4-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)Nc2nnc(C(CC)CC)s2)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-11(5-2)16-20-21-17(24-16)19-15(23)12-7-9-13(10-8-12)18-14(22)6-3/h7-11H,4-6H2,1-3H3,(H,18,22)(H,19,21,23) |
| InChIKey | PRCOGQSQMFOQHY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |