C9H15N3OS — CID 1086879
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 1086879) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1086879 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCC(CC)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C9H15N3OS/c1-4-7(5-2)8-11-12-9(14-8)10-6(3)13/h7H,4-5H2,1-3H3,(H,10,12,13) |
| InChIKey | KEUUZQVZXRTAER-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |