C10H18N4O2S — CID 110908064
1-(2-hydroxyethyl)-3-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 110908064) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 110908064 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCC(CC)c1nnc(NC(=O)NCCO)s1 |
| InChI | InChI=1S/C10H18N4O2S/c1-3-7(4-2)8-13-14-10(17-8)12-9(16)11-5-6-15/h7,15H,3-6H2,1-2H3,(H2,11,12,14,16) |
| InChIKey | ZSJAQIVVWOJIRR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |