C13H23N3OS — CID 4161855
2-methyl-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 4161855) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-methyl-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | 2-methyl-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 4161855 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-methyl-N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | CCCC(C)C(=O)Nc1nnc(C(CC)CC)s1 |
| InChI | InChI=1S/C13H23N3OS/c1-5-8-9(4)11(17)14-13-16-15-12(18-13)10(6-2)7-3/h9-10H,5-8H2,1-4H3,(H,14,16,17) |
| InChIKey | VHUNSXYHXJAUCF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |