C12H20N4O2S — CID 47332757
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-N'-propan-2-yloxamide (PubChem CID 47332757) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-N'-propan-2-yloxamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 47332757 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-N'-propan-2-yloxamide |
| SMILES | CCC(CC)c1nnc(NC(=O)C(=O)NC(C)C)s1 |
| InChI | InChI=1S/C12H20N4O2S/c1-5-8(6-2)11-15-16-12(19-11)14-10(18)9(17)13-7(3)4/h7-8H,5-6H2,1-4H3,(H,13,17)(H,14,16,18) |
| InChIKey | GJIVKYWTAJTZTQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|