C17H22N4O2S — CID 17154580
N-[3-oxo-3-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)amino]propyl]benzamide (PubChem CID 17154580) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[3-oxo-3-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)amino]propyl]benzamide.
| Compound Name | N-[3-oxo-3-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 17154580 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[3-oxo-3-[(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)amino]propyl]benzamide |
| SMILES | CCC(CC)c1nnc(NC(=O)CCNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C17H22N4O2S/c1-3-12(4-2)16-20-21-17(24-16)19-14(22)10-11-18-15(23)13-8-6-5-7-9-13/h5-9,12H,3-4,10-11H2,1-2H3,(H,18,23)(H,19,21,22) |
| InChIKey | SCMYUPFXWIYDAY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |