C23H28N4O6S — CID 55466931
N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55466931) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55466931 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[5-(1-adamantyl)-1,3,4-thiadiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2nnc(C34CC5CC(CC(C5)C3)C4)s2)cc1OC |
| InChI | InChI=1S/C23H28N4O6S/c1-31-3-4-33-19-9-17(27(29)30)16(8-18(19)32-2)20(28)24-22-26-25-21(34-22)23-10-13-5-14(11-23)7-15(6-13)12-23/h8-9,13-15H,3-7,10-12H2,1-2H3,(H,24,26,28) |
| InChIKey | DFBXQHAKCNKIOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|