C14H10N6O4S3 — CID 4604902
2-nitro-N-[5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4604902) has the molecular formula C14H10N6O4S3 and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-nitro-N-[5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2-nitro-N-[5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4604902 |
| Molecular Formula | C14H10N6O4S3 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-nitro-N-[5-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2ccccc2[N+](=O)[O-])s1)Nc1nccs1 |
| InChI | InChI=1S/C14H10N6O4S3/c21-10(16-12-15-5-6-25-12)7-26-14-19-18-13(27-14)17-11(22)8-3-1-2-4-9(8)20(23)24/h1-6H,7H2,(H,15,16,21)(H,17,18,22) |
| InChIKey | FVFPMNKBYFZANV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|