C22H21N5O6S — CID 17203320
4,5-dimethoxy-N-[5-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide (PubChem CID 17203320) has the molecular formula C22H21N5O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[5-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-[5-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 17203320 |
| Molecular Formula | C22H21N5O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 4,5-dimethoxy-N-[5-[1-(4-methylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(C3CC(=O)N(c4ccc(C)cc4)C3)s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C22H21N5O6S/c1-12-4-6-14(7-5-12)26-11-13(8-19(26)28)21-24-25-22(34-21)23-20(29)15-9-17(32-2)18(33-3)10-16(15)27(30)31/h4-7,9-10,13H,8,11H2,1-3H3,(H,23,25,29) |
| InChIKey | PKYGZSSHUYCYHR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|