C14H14N2S — CID 39106643
3-benzo[e][1,3]benzothiazol-2-ylpropan-1-amine (PubChem CID 39106643) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-benzo[e][1,3]benzothiazol-2-ylpropan-1-amine.
| Compound Name | 3-benzo[e][1,3]benzothiazol-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 39106643 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-benzo[e][1,3]benzothiazol-2-ylpropan-1-amine |
| SMILES | NCCCc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C14H14N2S/c15-9-3-6-13-16-14-11-5-2-1-4-10(11)7-8-12(14)17-13/h1-2,4-5,7-8H,3,6,9,15H2 |
| InChIKey | RLSDKEWQIPGABL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |