C8H6N2O2S — CID 119093125
4-methyl-2-nitro-1,3-benzothiazole (PubChem CID 119093125) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 4-methyl-2-nitro-1,3-benzothiazole.
| Compound Name | 4-methyl-2-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 119093125 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 4-methyl-2-nitro-1,3-benzothiazole |
| SMILES | Cc1cccc2sc([N+](=O)[O-])nc12 |
| InChI | InChI=1S/C8H6N2O2S/c1-5-3-2-4-6-7(5)9-8(13-6)10(11)12/h2-4H,1H3 |
| InChIKey | DLEHMONLXIJSNW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|