C20H18N6O2S — CID 23484884
6-N-(3,4-dimethylphenyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23484884) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 6-N-(3,4-dimethylphenyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(3,4-dimethylphenyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23484884 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 6-N-(3,4-dimethylphenyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc(Nc2ncnc(Nc3nc4c(C)cccc4s3)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C20H18N6O2S/c1-11-7-8-14(9-13(11)3)23-18-17(26(27)28)19(22-10-21-18)25-20-24-16-12(2)5-4-6-15(16)29-20/h4-10H,1-3H3,(H2,21,22,23,24,25) |
| InChIKey | SRGRIWKXQIHPEB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|