C20H17N7O3S — CID 22534348
N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 22534348) has the molecular formula C20H17N7O3S and a molecular weight of 435.47 g/mol. Its IUPAC name is N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 22534348 |
| Molecular Formula | C20H17N7O3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | Cc1cccc2sc(Nc3ncnc(NNC(=O)Cc4ccccc4)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C20H17N7O3S/c1-12-6-5-9-14-16(12)23-20(31-14)24-18-17(27(29)30)19(22-11-21-18)26-25-15(28)10-13-7-3-2-4-8-13/h2-9,11H,10H2,1H3,(H,25,28)(H2,21,22,23,24,26) |
| InChIKey | XHJJIXSGUSHHMH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|