C19H14N8O5S — CID 22534334
N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22534334) has the molecular formula C19H14N8O5S and a molecular weight of 466.44 g/mol. Its IUPAC name is N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22534334 |
| Molecular Formula | C19H14N8O5S |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | Cc1cccc2sc(Nc3ncnc(NNC(=O)c4cccc([N+](=O)[O-])c4)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C19H14N8O5S/c1-10-4-2-7-13-14(10)22-19(33-13)23-16-15(27(31)32)17(21-9-20-16)24-25-18(28)11-5-3-6-12(8-11)26(29)30/h2-9H,1H3,(H,25,28)(H2,20,21,22,23,24) |
| InChIKey | PURJQXYBCLBMLA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|