C18H12BrN5O3S — CID 22534405
N-[6-(4-bromophenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 22534405) has the molecular formula C18H12BrN5O3S and a molecular weight of 458.30 g/mol. Its IUPAC name is N-[6-(4-bromophenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[6-(4-bromophenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 22534405 |
| Molecular Formula | C18H12BrN5O3S |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | N-[6-(4-bromophenoxy)-5-nitropyrimidin-4-yl]-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(Nc3ncnc(Oc4ccc(Br)cc4)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C18H12BrN5O3S/c1-10-3-2-4-13-14(10)22-18(28-13)23-16-15(24(25)26)17(21-9-20-16)27-12-7-5-11(19)6-8-12/h2-9H,1H3,(H,20,21,22,23) |
| InChIKey | KSUXCBFGBDVIGZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|