C13H11N3S2 — CID 101405851
N-(4-methyl-1,3-benzothiazol-2-yl)pyrrole-1-carbothioamide (PubChem CID 101405851) has the molecular formula C13H11N3S2 and a molecular weight of 273.39 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)pyrrole-1-carbothioamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)pyrrole-1-carbothioamide |
|---|---|
| PubChem CID | 101405851 |
| Molecular Formula | C13H11N3S2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)pyrrole-1-carbothioamide |
| SMILES | Cc1cccc2sc(NC(=S)n3cccc3)nc12 |
| InChI | InChI=1S/C13H11N3S2/c1-9-5-4-6-10-11(9)14-12(18-10)15-13(17)16-7-2-3-8-16/h2-8H,1H3,(H,14,15,17) |
| InChIKey | ZMFQAHPPRNJERB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|