C21H15F2N3OS — CID 24759814
N-(2-anilino-1,3-benzothiazol-4-yl)-2-(3,5-difluorophenyl)acetamide (PubChem CID 24759814) has the molecular formula C21H15F2N3OS and a molecular weight of 395.43 g/mol. Its IUPAC name is N-(2-anilino-1,3-benzothiazol-4-yl)-2-(3,5-difluorophenyl)acetamide.
| Compound Name | N-(2-anilino-1,3-benzothiazol-4-yl)-2-(3,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 24759814 |
| Molecular Formula | C21H15F2N3OS |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-(2-anilino-1,3-benzothiazol-4-yl)-2-(3,5-difluorophenyl)acetamide |
| SMILES | O=C(Cc1cc(F)cc(F)c1)Nc1cccc2sc(Nc3ccccc3)nc12 |
| InChI | InChI=1S/C21H15F2N3OS/c22-14-9-13(10-15(23)12-14)11-19(27)25-17-7-4-8-18-20(17)26-21(28-18)24-16-5-2-1-3-6-16/h1-10,12H,11H2,(H,24,26)(H,25,27) |
| InChIKey | CDBALJJHVDEXTE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |