C22H14Cl2N4OS — CID 24760169
N-(2-anilino-1,3-benzothiazol-4-yl)-4,6-dichloro-1H-indole-2-carboxamide (PubChem CID 24760169) has the molecular formula C22H14Cl2N4OS and a molecular weight of 453.35 g/mol. Its IUPAC name is N-(2-anilino-1,3-benzothiazol-4-yl)-4,6-dichloro-1H-indole-2-carboxamide.
| Compound Name | N-(2-anilino-1,3-benzothiazol-4-yl)-4,6-dichloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 24760169 |
| Molecular Formula | C22H14Cl2N4OS |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | N-(2-anilino-1,3-benzothiazol-4-yl)-4,6-dichloro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cccc2sc(Nc3ccccc3)nc12)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H14Cl2N4OS/c23-12-9-15(24)14-11-18(26-17(14)10-12)21(29)27-16-7-4-8-19-20(16)28-22(30-19)25-13-5-2-1-3-6-13/h1-11,26H,(H,25,28)(H,27,29) |
| InChIKey | DVGYOKVLZNTRMM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |