About N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide
N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide (PubChem CID 24759968) has the molecular formula C22H19N3OS
and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide |
| PubChem CID | 24759968 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2cccc3sc(Nc4ccccc4)nc23)c1 |
| InChI | InChI=1S/C22H19N3OS/c1-14-11-15(2)13-16(12-14)21(26)24-18-9-6-10-19-20(18)25-22(27-19)23-17-7-4-3-5-8-17/h3-13H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | YEWRIYJJJDGTJO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide?
The IUPAC name of N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide (CID 24759968) is N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide.
What is the SMILES notation for N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide?
The canonical SMILES for N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)Nc2cccc3sc(Nc4ccccc4)nc23)c1.
What is the InChIKey of N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide?
The InChIKey is YEWRIYJJJDGTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3OS/c1-14-11-15(2)13-16(12-14)21(26)24-18-9-6-10-19-20(18)25-22(27-19)23-17-7-4-3-5-8-17/h3-13H,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide?
N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide has a molecular weight of 373.48 g/mol, XLogP of 5.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-anilino-1,3-benzothiazol-4-yl)-3,5-dimethylbenzamide is sourced from PubChem (CID 24759968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).