C17H14ClN3O2S — CID 91431214
2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-N-(2-chlorophenyl)acetamide (PubChem CID 91431214) has the molecular formula C17H14ClN3O2S and a molecular weight of 359.84 g/mol. Its IUPAC name is 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 91431214 |
| Molecular Formula | C17H14ClN3O2S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(Cc1sc(Nc2ccccc2)nc1O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H14ClN3O2S/c18-12-8-4-5-9-13(12)20-15(22)10-14-16(23)21-17(24-14)19-11-6-2-1-3-7-11/h1-9,23H,10H2,(H,19,21)(H,20,22) |
| InChIKey | AXWWKZDJADAHTI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |