C17H21N3O2S — CID 90931288
2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone (PubChem CID 90931288) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone.
| Compound Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone |
|---|---|
| PubChem CID | 90931288 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone |
| SMILES | O=C(Cc1sc(Nc2ccccc2)nc1O)N1CCCCCC1 |
| InChI | InChI=1S/C17H21N3O2S/c21-15(20-10-6-1-2-7-11-20)12-14-16(22)19-17(23-14)18-13-8-4-3-5-9-13/h3-5,8-9,22H,1-2,6-7,10-12H2,(H,18,19) |
| InChIKey | BVALVJYMEMGVBM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |