About 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone
2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone (PubChem CID 90931288) has the molecular formula C17H21N3O2S
and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone |
| PubChem CID | 90931288 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone |
| SMILES | O=C(Cc1sc(Nc2ccccc2)nc1O)N1CCCCCC1 |
| InChI | InChI=1S/C17H21N3O2S/c21-15(20-10-6-1-2-7-11-20)12-14-16(22)19-17(23-14)18-13-8-4-3-5-9-13/h3-5,8-9,22H,1-2,6-7,10-12H2,(H,18,19) |
| InChIKey | BVALVJYMEMGVBM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone?
The IUPAC name of 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone (CID 90931288) is 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone.
What is the SMILES notation for 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone?
The canonical SMILES for 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone is O=C(Cc1sc(Nc2ccccc2)nc1O)N1CCCCCC1.
What is the InChIKey of 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone?
The InChIKey is BVALVJYMEMGVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2S/c21-15(20-10-6-1-2-7-11-20)12-14-16(22)19-17(23-14)18-13-8-4-3-5-9-13/h3-5,8-9,22H,1-2,6-7,10-12H2,(H,18,19).
What are the key properties of 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone?
2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone has a molecular weight of 331.44 g/mol, XLogP of 3.54, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-4-hydroxy-1,3-thiazol-5-yl)-1-(azepan-1-yl)ethanone is sourced from PubChem (CID 90931288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).