C19H14N2O2S — CID 174923780
N-[4-(3-phenylprop-2-enoyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 174923780) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[4-(3-phenylprop-2-enoyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-(3-phenylprop-2-enoyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 174923780 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[4-(3-phenylprop-2-enoyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(C(=O)C=Cc2ccccc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O2S/c22-17(12-11-14-7-3-1-4-8-14)16-13-24-19(20-16)21-18(23)15-9-5-2-6-10-15/h1-13H,(H,20,21,23) |
| InChIKey | JNZITPITEHOGCC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|