C21H19N3O4S2 — CID 43853538
4-(2,5-dioxopyrrolidin-1-yl)-3-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 43853538) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-3-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-3-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 43853538 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-3-methyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2csc(NS(=O)(=O)c3ccc(N4C(=O)CCC4=O)c(C)c3)n2)cc1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-13-3-5-15(6-4-13)17-12-29-21(22-17)23-30(27,28)16-7-8-18(14(2)11-16)24-19(25)9-10-20(24)26/h3-8,11-12H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | WMERQVUYNZPMMA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|