C23H18N2O2S2 — CID 25036163
N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-4-methylbenzenesulfonamide (PubChem CID 25036163) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25036163 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc(-c3ccc4c(c3)Cc3ccccc3-4)cs2)cc1 |
| InChI | InChI=1S/C23H18N2O2S2/c1-15-6-9-19(10-7-15)29(26,27)25-23-24-22(14-28-23)17-8-11-21-18(13-17)12-16-4-2-3-5-20(16)21/h2-11,13-14H,12H2,1H3,(H,24,25) |
| InChIKey | CJYFOCBRXFTVLG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|