C19H14N2O2S2 — CID 5234678
N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 5234678) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5234678 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccc3ccccc3c2)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O2S2/c22-25(23,17-8-2-1-3-9-17)21-19-20-18(13-24-19)16-11-10-14-6-4-5-7-15(14)12-16/h1-13H,(H,20,21) |
| InChIKey | WZPUFGKWFFGKGH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|