C20H17N3O4S2 — CID 122286657
4-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 122286657) has the molecular formula C20H17N3O4S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122286657 |
| Molecular Formula | C20H17N3O4S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1nc(-c2ccc(NS(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)cc2)cs1 |
| InChI | InChI=1S/C20H17N3O4S2/c1-13-21-18(12-28-13)14-2-4-15(5-3-14)22-29(26,27)17-8-6-16(7-9-17)23-19(24)10-11-20(23)25/h2-9,12,22H,10-11H2,1H3 |
| InChIKey | MBKHTPHMEFRFSN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|