C19H20N2O6S — CID 43853558
N-(3,4-dimethoxyphenyl)-4-(2,5-dioxopyrrolidin-1-yl)-3-methylbenzenesulfonamide (PubChem CID 43853558) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-(2,5-dioxopyrrolidin-1-yl)-3-methylbenzenesulfonamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-(2,5-dioxopyrrolidin-1-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43853558 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-(2,5-dioxopyrrolidin-1-yl)-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(N3C(=O)CCC3=O)c(C)c2)cc1OC |
| InChI | InChI=1S/C19H20N2O6S/c1-12-10-14(5-6-15(12)21-18(22)8-9-19(21)23)28(24,25)20-13-4-7-16(26-2)17(11-13)27-3/h4-7,10-11,20H,8-9H2,1-3H3 |
| InChIKey | ZPVWVZYWMJEACM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|