C11H11N3O2S3 — CID 106267684
5-cyano-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 106267684) has the molecular formula C11H11N3O2S3 and a molecular weight of 313.43 g/mol. Its IUPAC name is 5-cyano-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106267684 |
| Molecular Formula | C11H11N3O2S3 |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 5-cyano-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | CC(C)c1csc(NS(=O)(=O)c2ccc(C#N)s2)n1 |
| InChI | InChI=1S/C11H11N3O2S3/c1-7(2)9-6-17-11(13-9)14-19(15,16)10-4-3-8(5-12)18-10/h3-4,6-7H,1-2H3,(H,13,14) |
| InChIKey | XYWSQVOQOGAZJL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |