C10H11N3O3S2 — CID 99837871
6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide (PubChem CID 99837871) has the molecular formula C10H11N3O3S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 99837871 |
| Molecular Formula | C10H11N3O3S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 6-methoxy-N-(4-methyl-1,3-thiazol-2-yl)pyridine-3-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc(C)cs2)cn1 |
| InChI | InChI=1S/C10H11N3O3S2/c1-7-6-17-10(12-7)13-18(14,15)8-3-4-9(16-2)11-5-8/h3-6H,1-2H3,(H,12,13) |
| InChIKey | BBLZUZIUZKFQPC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |