C12H12N2O5S2 — CID 81264697
2-[2-[(3-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 81264697) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[2-[(3-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(3-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 81264697 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-[2-[(3-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1cccc(S(=O)(=O)Nc2nc(CC(=O)O)cs2)c1 |
| InChI | InChI=1S/C12H12N2O5S2/c1-19-9-3-2-4-10(6-9)21(17,18)14-12-13-8(7-20-12)5-11(15)16/h2-4,6-7H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | SIPMCZZIJHGJSF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |