C13H14N2O6S2 — CID 20983652
2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20983652) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20983652 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[2-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc(CC(=O)O)cs2)cc1OC |
| InChI | InChI=1S/C13H14N2O6S2/c1-20-10-4-3-9(6-11(10)21-2)23(18,19)15-13-14-8(7-22-13)5-12(16)17/h3-4,6-7H,5H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | DFXAHRKHDUESEH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |